| Product Name | ethyl 2-(2-bromo-4,5-dichloro-1H-imidazol-1-yl)acetate |
| CAS No. | 154082-06-1 |
| Synonyms | ethyl (2-bromo-4,5-dichloro-1H-imidazol-1-yl)acetate |
| InChI | InChI=1/C7H7BrCl2N2O2/c1-2-14-4(13)3-12-6(10)5(9)11-7(12)8/h2-3H2,1H3 |
| Molecular Formula | C7H7BrCl2N2O2 |
| Molecular Weight | 301.9527 |
| Density | 1.81g/cm3 |
| Melting point | 42℃ |
| Boiling point | 393°C at 760 mmHg |
| Flash point | 191.5°C |
| Refractive index | 1.615 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
154082-06-1 ethyl 2-(2-bromo-4,5-dichloro-1h-imidazol-1-yl)acetate
service@apichina.com