| Product Name | ethyl 1-naphthoate |
| CAS No. | 3007-97-4 |
| Synonyms | Ethyl 1-naphthoate, (1-Naphthoic acid ethyl es; 1-Naphthoic acid ethyl ester; Ethyl1-naphthoate, (1-Naphthoicacidethylester); ethyl naphthalene-1-carboxylate |
| InChI | InChI=1/C13H12O2/c1-2-15-13(14)12-9-5-7-10-6-3-4-8-11(10)12/h3-9H,2H2,1H3 |
| Molecular Formula | C13H12O2 |
| Molecular Weight | 200.2332 |
| Density | 1.125g/cm3 |
| Boiling point | 310°C at 760 mmHg |
| Flash point | 148.7°C |
| Refractive index | 1.595 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
3007-97-4 ethyl 1-naphthoate
service@apichina.com