| Product Name | Ethyl 1,4-dihydro-8-fluoro-4-oxoquinoline-3-carboxylate |
| CAS No. | 71083-06-2 |
| Synonyms | Ethyl 8-fluoro-4-hydroxyquinoline-3-; Ethyl 8-fluoro-4-oxo-1,4-dihydroquinoline-3-carboxylate; [chloro(fluoro)methyl]benzene |
| InChI | InChI=1/C7H6ClF/c8-7(9)6-4-2-1-3-5-6/h1-5,7H |
| Molecular Formula | C7H6ClF |
| Molecular Weight | 144.5739 |
| Density | 1.172g/cm3 |
| Melting point | 217-219℃ |
| Boiling point | 166.1°C at 760 mmHg |
| Flash point | 53.7°C |
| Refractive index | 1.498 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
71083-06-2 ethyl 1,4-dihydro-8-fluoro-4-oxoquinoline-3-carboxylate
service@apichina.com