| Product Name | ethyl 1-(3-aminobenzyl)piperidine-4-carboxylate |
| CAS No. | 306937-22-4 |
| InChI | InChI=1/C15H22N2O2/c1-2-19-15(18)13-6-8-17(9-7-13)11-12-4-3-5-14(16)10-12/h3-5,10,13H,2,6-9,11,16H2,1H3 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.3474 |
| Density | 1.129g/cm3 |
| Melting point | 49℃ |
| Boiling point | 384.1°C at 760 mmHg |
| Flash point | 186.1°C |
| Refractive index | 1.564 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
306937-22-4 ethyl 1-(3-aminobenzyl)piperidine-4-carboxylate
service@apichina.com