| Product Name | ethyl 1-(2-furylmethyl)-4,5-dioxopyrrolidine-3-carboxylate |
| CAS No. | 142774-43-4 |
| Synonyms | ethyl 1-(furan-2-ylmethyl)-4,5-dioxopyrrolidine-3-carboxylate |
| InChI | InChI=1/C12H13NO5/c1-2-17-12(16)9-7-13(11(15)10(9)14)6-8-4-3-5-18-8/h3-5,9H,2,6-7H2,1H3 |
| Molecular Formula | C12H13NO5 |
| Molecular Weight | 251.2353 |
| Density | 1.336g/cm3 |
| Melting point | 127℃ |
| Boiling point | 372.9°C at 760 mmHg |
| Flash point | 179.3°C |
| Refractive index | 1.543 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
142774-43-4 ethyl 1-(2-furylmethyl)-4,5-dioxopyrrolidine-3-carboxylate
service@apichina.com