| Product Name | Ethanone, 1-(5-bromo-3-pyridinyl)- |
| CAS No. | 38940-62-4 |
| Synonyms | 3-Acetyl-5-bromopyridine; 1-(5-bromopyridin-3-yl)ethanone |
| InChI | InChI=1/C7H6BrNO/c1-5(10)6-2-7(8)4-9-3-6/h2-4H,1H3 |
| Molecular Formula | C7H6BrNO |
| Molecular Weight | 200.0326 |
| Density | 1.534g/cm3 |
| Boiling point | 279.321°C at 760 mmHg |
| Flash point | 122.729°C |
| Refractive index | 1.558 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
38940-62-4 ethanone, 1-(5-bromo-3-pyridinyl)-
service@apichina.com