| Product Name | endo-Bicyclo[2.2.2]oct-5-ene-2,3-dicarboxylic anhydride |
| CAS No. | 24327-08-0 |
| InChI | InChI=1/C10H10O3/c11-9-7-5-1-2-6(4-3-5)8(7)10(12)13-9/h1-2,5-8H,3-4H2 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.1846 |
| Density | 1.324g/cm3 |
| Melting point | 144-148℃ |
| Boiling point | 340.9°C at 760 mmHg |
| Flash point | 166.5°C |
| Refractive index | 1.563 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S22:Do not inhale dust.; |
24327-08-0 endo-bicyclo[2.2.2]oct-5-ene-2,3-dicarboxylic anhydride
service@apichina.com