| Product Name | Dodecyltriethoxysilane |
| CAS No. | 18536-91-9 |
| Synonyms | n-Dodecyltriethoxysilane; n-Diethoxytrethoxysilane; hexadecane-2,15-dione |
| InChI | InChI=1/C16H30O2/c1-15(17)13-11-9-7-5-3-4-6-8-10-12-14-16(2)18/h3-14H2,1-2H3 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.4082 |
| Density | 0.886g/cm3 |
| Boiling point | 353.1°C at 760 mmHg |
| Flash point | 132.5°C |
| Refractive index | 1.444 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
18536-91-9 dodecyltriethoxysilane
service@apichina.com