| Product Name | Dodecanoic acid, mixed esters with decanoic acid, octanoic acid and trimethylolethane |
| CAS No. | 68411-73-4 |
| Synonyms | Trimethylolethane caprylate, caprate, laurate; Trimethylolethane octanoate decanoate laurate; 1-(decanoyloxy)-2-(octanoyloxy)ethyl dodecanoate |
| InChI | InChI=1/C32H60O6/c1-4-7-10-13-15-16-18-21-24-27-31(35)38-32(28-36-29(33)25-22-19-12-9-6-3)37-30(34)26-23-20-17-14-11-8-5-2/h32H,4-28H2,1-3H3 |
| Molecular Formula | C32H60O6 |
| Molecular Weight | 540.8152 |
| Density | 0.952g/cm3 |
| Boiling point | 586.9°C at 760 mmHg |
| Flash point | 238.2°C |
| Refractive index | 1.46 |
68411-73-4 dodecanoic acid, mixed esters with decanoic acid, octanoic acid and trimethylolethane
service@apichina.com