| Product Name | dodecanedioic acid, compound with hexane-1,6-diamine (1:1) |
| CAS No. | 13188-60-8 |
| Synonyms | Nylon 6-12 salt; Dodecanedioic acid, compd. with 1,6-hexanediamine (1:1); Dodecanedioic acid, compound with hexane-1,6-diamine (1:1); dodecanedioic acid - hexane-1,6-diamine (1:1) |
| InChI | InChI=1/C12H22O4.C6H16N2/c13-11(14)9-7-5-3-1-2-4-6-8-10-12(15)16;7-5-3-1-2-4-6-8/h1-10H2,(H,13,14)(H,15,16);1-8H2 |
| Molecular Formula | C18H38N2O4 |
| Molecular Weight | 346.5053 |
| Boiling point | 394°C at 760 mmHg |
| Flash point | 216.6°C |
13188-60-8 dodecanedioic acid, compound with hexane-1,6-diamine (1:1)
service@apichina.com