| Product Name | docosanoic acid, monoester with glycerol |
| CAS No. | 30233-64-8 |
| Synonyms | 2,3-Dihydroxypropyl docosanoate; Docosanoic acid, 2,3-dihydroxypropyl ester; Docosanoic acid, monoester with 1,2,3-propanetriol; Glyceryl monobehenate; Behenic monoglyceride; Glycerine monobehenate; Docosanoic acid, monoester with glycerol; 1,3-dihydroxypropan-2-yl docosanoate |
| InChI | InChI=1/C25H50O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25(28)29-24(22-26)23-27/h24,26-27H,2-23H2,1H3 |
| Molecular Formula | C25H50O4 |
| Molecular Weight | 414.6621 |
| Density | 0.942g/cm3 |
| Boiling point | 533.8°C at 760 mmHg |
| Flash point | 164.6°C |
| Refractive index | 1.469 |
30233-64-8 docosanoic acid, monoester with glycerol
service@apichina.com