| Product Name | DL-Tartaric Acid |
| CAS No. | 133-37-9;138508-61-9 |
| Synonyms | DL-Dihydroxysuccinic acid; DL-Tartaric acid anhydrous; DL-Tartaric Acid Anhy; (+-)-Tartaric acid; (2RS,3RS)-Tartaric acid; Butanedioic acid, 2,3-dihydroxy-, (R*,R*)-; DL-Tartrate; Paratartaric aicd; Racemic tartaric acid; Resolvable tartaric acid; Uvic acid; Butanedioic acid, 2,3-dihydroxy-, (2R,3R)-rel-; Butanedioic acid, 2,3-dihydroxy-, (theta,theta)-(+-)-; (2S,3S)-2,3-dihydroxybutanedioic acid; (2R,3R)-2,3-dihydroxybutanedioic acid; DL TARTARIC ACID |
| InChI | InChI=1/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10)/t1-,2-/m1/s1 |
| Molecular Formula | C4H6O6 |
| Molecular Weight | 150.0868 |
| Density | 1.886g/cm3 |
| Melting point | 206℃ |
| Boiling point | 399.3°C at 760 mmHg |
| Flash point | 209.4°C |
| Water solubility | soluble; 20.6(20℃) |
| Refractive index | 1.585 |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:; S37:; S39:; |
133-37-9;138508-61-9 dl-tartaric acid
service@apichina.com