| Product Name | DL-Phenylalanine methyl ester hydrochloride |
| CAS No. | 5619-07-8 |
| Synonyms | H-DL-Phe-OMe.HCl; methyl L-phenylalaninate hydrochloride (1:1); methyl phenylalaninate hydrochloride; H-DL-Phe-OMe・HCl |
| InChI | InChI=1/C10H13NO2.ClH/c1-13-10(12)9(11)7-8-5-3-2-4-6-8;/h2-6,9H,7,11H2,1H3;1H |
| Molecular Formula | C10H14ClNO2 |
| Molecular Weight | 215.6767 |
| Boiling point | 264.2°C at 760 mmHg |
| Flash point | 126°C |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
5619-07-8 dl-phenylalanine methyl ester hydrochloride
service@apichina.com