| Product Name | dl-O-tyrosine |
| CAS No. | 2370-61-8 |
| Synonyms | 3-(2-Hydroxyphenyl)-DL-alanine~H-DL-Phe(2-OH)-OH; 2-hydroxyphenylalanine; 2-amino-3-(1H-indol-3-yl)propan-1-ol ethanedioate (salt) |
| InChI | InChI=1/C11H14N2O.C2H2O4/c12-9(7-14)5-8-6-13-11-4-2-1-3-10(8)11;3-1(4)2(5)6/h1-4,6,9,13-14H,5,7,12H2;(H,3,4)(H,5,6) |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.2765 |
| Melting point | 260℃ |
| Boiling point | 654.4°C at 760 mmHg |
| Flash point | 349.5°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
2370-61-8 dl-o-tyrosine
service@apichina.com