| Product Name | DL-Bromosuccinic acid |
| CAS No. | 923-06-8 |
| Synonyms | Bromobutanedioic acid; Bromosuccinic Acid; 2-bromobutanedioic acid; (2R)-2-bromobutanedioate; (2S)-2-bromobutanedioate |
| InChI | InChI=1/C4H5BrO4/c5-2(4(8)9)1-3(6)7/h2H,1H2,(H,6,7)(H,8,9)/p-2/t2-/m0/s1 |
| Molecular Formula | C4H3BrO4 |
| Molecular Weight | 194.9693 |
| Melting point | 160-162℃ |
| Boiling point | 255.1°C at 760 mmHg |
| Flash point | 108.1°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
923-06-8 dl-bromosuccinic acid
service@apichina.com