| Product Name | DL-4-Chlorophenylalanine ethyl ester hydrochloride |
| CAS No. | 52031-05-7 |
| Synonyms | DL-p-Chlorophenylalanine ethyl ester hydrochloride; H-Phe(4-Cl)-OEt.HCl; 3-(4-Chlorophenyl)-DL-alanine ethyl ester hydrochloride; ethyl 4-chlorophenylalaninate; ethyl 4-chlorophenylalaninate hydrochloride; (2R)-3-(4-chlorophenyl)-1-ethoxy-1-oxopropan-2-aminium; (2S)-3-(4-chlorophenyl)-1-ethoxy-1-oxopropan-2-aminium |
| InChI | InChI=1/C11H14ClNO2/c1-2-15-11(14)10(13)7-8-3-5-9(12)6-4-8/h3-6,10H,2,7,13H2,1H3/p+1/t10-/m0/s1 |
| Molecular Formula | C11H15ClNO2 |
| Molecular Weight | 228.6948 |
| Melting point | 166-170℃ |
| Boiling point | 312.2°C at 760 mmHg |
| Flash point | 142.6°C |
| Safety | S24/25:Avoid contact with skin and eyes.; |
52031-05-7 dl-4-chlorophenylalanine ethyl ester hydrochloride
service@apichina.com