| Product Name | dl-3-phenyllactic acid |
| CAS No. | 828-01-3 |
| Synonyms | DL-?-Phenyllactic acid ()-2-Hydroxy-3-phenylpropionic acid; (+/-)-3-Phenyllactic acid; (+/-)-2-Hydroxy-3-phenylpropionic acid; DL-3-Phenyllactic acid, (DL-2-Hydroxy-3-phenylpropionic acid); 3,3',3'',3'''-[3,8-bis(carboxymethyl)-13,17-dimethylporphyrin-2,7,12,18-tetrayl]tetrapropanoic acid; Dl-Beta-Phenyllactic Acid |
| InChI | InChI=1/C38H38N4O12/c1-17-19(3-7-33(43)44)27-14-29-21(5-9-35(47)48)24(12-38(53)54)32(41-29)16-30-22(6-10-36(49)50)23(11-37(51)52)31(42-30)15-28-20(4-8-34(45)46)18(2)26(40-28)13-25(17)39-27/h13-16,40-41H,3-12H2,1-2H3,(H,43,44)(H,45,46)(H,47,48)(H,49,50)(H,51,52)(H,53,54)/b25-13-,26-13-,27-14-,28-15-,29-14-,30-16-,31-15-,32-16- |
| Molecular Formula | C38H38N4O12 |
| Molecular Weight | 742.7279 |
| Density | 1.478g/cm3 |
| Melting point | 95-98℃ |
| Boiling point | 1399.4°C at 760 mmHg |
| Flash point | 800.1°C |
| Refractive index | 1.656 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
828-01-3 dl-3-phenyllactic acid
service@apichina.com