| Product Name | DL-2-Chloro-2-phenylacetyl chloride |
| CAS No. | 2912-62-1 |
| Synonyms | Chloro(phenyl)acetyl chloride; CCRIS 8624; (2S)-chloro(phenyl)ethanoyl chloride; (2R)-chloro(phenyl)ethanoyl chloride |
| InChI | InChI=1/C8H6Cl2O/c9-7(8(10)11)6-4-2-1-3-5-6/h1-5,7H/t7-/m1/s1 |
| Molecular Formula | C8H6Cl2O |
| Molecular Weight | 189.0386 |
| Density | 1.322g/cm3 |
| Boiling point | 228°C at 760 mmHg |
| Flash point | 104.4°C |
| Refractive index | 1.55 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; R36/37:Irritating to eyes and respiratory system.; |
| Safety | S25:Avoid contact with eyes.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
2912-62-1 dl-2-chloro-2-phenylacetyl chloride
service@apichina.com