| Product Name | DL-2-Amino-4-pentenoic acid |
| CAS No. | 7685-44-1;1069-48-3 |
| Synonyms | DL-Allylglycine 2-Amino-4-pentenoic acid; DL-2-aminopent-4-enoic acid; 2-aminopent-4-enoic acid; N-prop-2-en-1-ylglycine |
| InChI | InChI=1/C5H9NO2/c1-2-3-4(6)5(7)8/h2,4H,1,3,6H2,(H,7,8)/t4-/m1/s1 |
| Molecular Formula | C5H9NO2 |
| Molecular Weight | 115.1305 |
| Density | 1.098g/cm3 |
| Melting point | 251-253℃ |
| Boiling point | 231°C at 760 mmHg |
| Flash point | 93.5°C |
| Refractive index | 1.484 |
| Safety | S22:; S24/25:Avoid contact with skin and eyes.; |
7685-44-1;1069-48-3 dl-2-amino-4-pentenoic acid
service@apichina.com