| Product Name | Divinyloxyethane |
| CAS No. | 1069-23-4 |
| Synonyms | 1,5-Hexadiene-3,4-diol,mixture of (? and meso; hexa-1,5-diene-3,4-diol; 1,2-Divinyl Glycol; 3,4-Dihydroxy-1,5-hexadiene; 1,5-Hexadiene-3,4-diol; Aldehyde C9; 4-Dimethoxy-4-Xylene Dimethyl Ether; Divinyl glycol |
| InChI | InChI=1/C6H10O2/c1-3-5(7)6(8)4-2/h3-8H,1-2H2 |
| Molecular Formula | C6H10O2 |
| Molecular Weight | 114.1424 |
| Density | 1.005g/cm3 |
| Melting point | 14-16℃ |
| Boiling point | 201.9°C at 760 mmHg |
| Flash point | 92.8°C |
| Refractive index | 1.48 |
| Hazard Symbols |  T:Toxic; |
| Risk Codes | R23/24/25:; |
| Safety | S26:; S28:; S36/37/39:; S45:; |
1069-23-4 divinyloxyethane
service@apichina.com