| Product Name | Dithiocarbonic acid S-(2-aminoethyl) ester S-ester with 4-mercaptobuty ric acid hydrochloride |
| CAS No. | 19213-25-3 |
| Synonyms | Carbonic acid, dithio-, S-(2-aminoethyl) ester, S-ester with 4-mercaptobutyric acid, hydrochloride; Dithiocarbonic acid S-(2-aminoethyl) ester S-ester with 4-mercaptobutyric acid hydrochloride; 4-({[(2-aminoethyl)sulfanyl]carbonyl}sulfanyl)butanoic acid hydrochloride (1:1) |
| InChI | InChI=1/C7H13NO3S2.ClH/c8-3-5-13-7(11)12-4-1-2-6(9)10;/h1-5,8H2,(H,9,10);1H |
| Molecular Formula | C7H14ClNO3S2 |
| Molecular Weight | 259.774 |
| Boiling point | 402.2°C at 760 mmHg |
| Flash point | 197°C |
19213-25-3 dithiocarbonic acid s-(2-aminoethyl) ester s-ester with 4-mercaptobuty ric acid hydrochlo
service@apichina.com