| Product Name | Disperse Blue 1 |
| CAS No. | 2475-45-8 |
| InChI | InChI=1/C14H12N4O2/c15-5-1-2-6(16)10-9(5)13(19)11-7(17)3-4-8(18)12(11)14(10)20/h1-4H,15-18H2 |
| Molecular Formula | C14H12N4O2 |
| Molecular Weight | 268.2707 |
| Density | 1.595g/cm3 |
| Boiling point | 711.9°C at 760 mmHg |
| Flash point | 384.3°C |
| Refractive index | 1.857 |
| Hazard Symbols |  T:Toxic; |
| Risk Codes | R38:Irritating to skin.; R41:Risks of serious damage to eyes.; R43:May cause sensitization by skin contact.; R45:May cause cancer.; |
| Safety | S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; S53:Avoid exposure - obtain special instructions before use.; |
2475-45-8 disperse blue 1
service@apichina.com