| Product Name | dipropylene glycol monomethyl ether, mixture of isomers |
| CAS No. | 34590-94-8 |
| Synonyms | Di(propylene glycol) methyl ether; Methoxypropoxypropanol; Dipropylene glycol monomethyl ether; DPM |
| InChI | InChI=1/C7H16O3/c1-3-7(8)10-6-4-5-9-2/h7-8H,3-6H2,1-2H3 |
| Molecular Formula | C7H16O3 |
| Molecular Weight | 148.2001 |
| Density | 0.958g/cm3 |
| Boiling point | 155.6°C at 760 mmHg |
| Flash point | 47.9°C |
| Refractive index | 1.423 |
| Safety | S23:; S24/25:; |
34590-94-8 dipropylene glycol monomethyl ether, mixture of isomers
service@apichina.com