| Product Name | diphenylpropylphosphine |
| CAS No. | 7650-84-2 |
| Synonyms | Diphenyl-n-propylphosphine; n-Propyldiphenylphosphine; Diphenyln-propylphosphine; diphenyl(propyl)phosphane |
| InChI | InChI=1/C15H17P/c1-2-13-16(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12H,2,13H2,1H3 |
| Molecular Formula | C15H17P |
| Molecular Weight | 228.2692 |
| Boiling point | 304.1°C at 760 mmHg |
| Flash point | 150.5°C |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
7650-84-2 diphenylpropylphosphine
service@apichina.com