| Product Name | diphenylmaleic anhydride |
| CAS No. | 4808-48-4 |
| Synonyms | 2,3-Diphenylmaleic anhydride; 3,4-Diphenyl-2,5-furandione; 3,4-diphenylfuran-2,5-dione |
| InChI | InChI=1/C16H10O3/c17-15-13(11-7-3-1-4-8-11)14(16(18)19-15)12-9-5-2-6-10-12/h1-10H |
| Molecular Formula | C16H10O3 |
| Molecular Weight | 250.2488 |
| Density | 1.314g/cm3 |
| Melting point | 153-157℃ |
| Boiling point | 437.1°C at 760 mmHg |
| Flash point | 215.4°C |
| Refractive index | 1.642 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
4808-48-4 diphenylmaleic anhydride
service@apichina.com