| Product Name | diphenyliodonium trifluoromethane-sulfonate |
| CAS No. | 66003-76-7 |
| Synonyms | Diphenyliodonium Trifluoromethanesulfonate; Diphenyliodonium triflate |
| InChI | InChI=1/C12H10I.CHF3O3S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;2-1(3,4)8(5,6)7/h1-10H;(H,5,6,7)/q+1;/p-1 |
| Molecular Formula | C13H10F3IO3S |
| Molecular Weight | 430.1814 |
| Melting point | 177-179℃ |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
66003-76-7 diphenyliodonium trifluoromethane-sulfonate
service@apichina.com