| Product Name | Diphenyliodonium chloride |
| CAS No. | 1483-72-3 |
| Synonyms | Iodonium, diphenyl-, chloride (1:1); AI3-17092; NSC 134275; Iodonium, diphenyl-, chloride |
| InChI | InChI=1/C12H10I/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10H/q-1 |
| Molecular Formula | C12H10I |
| Molecular Weight | 281.11227 |
| Melting point | 227-235℃ |
| Hazard Symbols |  T:Toxic; |
| Risk Codes | R25:Toxic if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S28A:After contact with skin, wash immediately with plenty of water.; S37/39:Wear suitable gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
1483-72-3 diphenyliodonium chloride
service@apichina.com