| Product Name | Diphenylcyclopropenone |
| CAS No. | 886-38-4 |
| Synonyms | Diphencyprone; 2,3-diphenylcycloprop-2-en-1-one |
| InChI | InChI=1/C15H10O/c16-15-13(11-7-3-1-4-8-11)14(15)12-9-5-2-6-10-12/h1-10H |
| Molecular Formula | C15H10O |
| Molecular Weight | 206.2393 |
| Density | 1.232g/cm3 |
| Melting point | 119-121℃ |
| Boiling point | 407.2°C at 760 mmHg |
| Flash point | 182.7°C |
| Refractive index | 1.668 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R43:May cause sensitization by skin contact.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
886-38-4 diphenylcyclopropenone
service@apichina.com