| Product Name | Diphenylborinic acid 2-aminoethyl ester |
| CAS No. | 524-95-8 |
| Synonyms | 2-Aminoethyl diphenylborinate; diphenylborinic acid; Diphenylboric acid 2-aminoethyl ester; B-(2-Aminoethoxy)diphenylborane; 2-APB; Diphenylboric acid ethanolamine complex |
| InChI | InChI=1/C14H16BNO/c16-11-12-17-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10H,11-12,16H2 |
| Molecular Formula | C14H16BNO |
| Molecular Weight | 225.0939 |
| Density | 1.04g/cm3 |
| Melting point | 190-194℃ |
| Boiling point | 325.3°C at 760 mmHg |
| Flash point | 150.6°C |
| Refractive index | 1.559 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
524-95-8 diphenylborinic acid 2-aminoethyl ester
service@apichina.com