| Product Name | Diphenylacetic acid |
| CAS No. | 117-34-0 |
| Synonyms | Benzeneacetic acid, alpha-phenyl-; 2,2-Diphenylacetic Acid |
| InChI | InChI=1/C14H12O2/c15-14(16)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H,(H,15,16) |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.2439 |
| Density | 1.174g/cm3 |
| Melting point | 147-149℃ |
| Boiling point | 285°C at 760 mmHg |
| Flash point | 140.4°C |
| Refractive index | 1.599 |
| Hazard Symbols | |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
117-34-0 diphenylacetic acid
service@apichina.com
- Next:117-37-3 anisindione
- Previous:117-30-6 dipiproverine