Sales Email | Service@apichina.com |
CAS No. | 1539-04-4 |
Product Name | Diphenyl tere-phthalate |
Synonyms | Diphenyl terephthalate; Terephthalic acid diphenyl ester; diphenyl benzene-1,4-dicarboxylate |
InChI | InChI=1/C20H14O4/c21-19(23-17-7-3-1-4-8-17)15-11-13-16(14-12-15)20(22)24-18-9-5-2-6-10-18/h1-14H |
Molecular Formula | C20H14O4 |
Molecular Weight | 318.3228 |
Density | 1.242g/cm3 |
Melting point | 197-199℃ |
Boiling point | 496.6°C at 760 mmHg |
Flash point | 255°C |
Refractive index | 1.615 |
Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |