| Product Name | Diphenyl phosphite |
| CAS No. | 4712-55-4 |
| Synonyms | diphenyl phosphonate; Phosphonic acid diphenyl ester; diphenyl hydrogen phosphite; oxo(diphenoxy)phosphonium |
| InChI | InChI=1/C12H11O3P/c13-16(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1-10,16H |
| Molecular Formula | C12H11O3P |
| Molecular Weight | 234.1877 |
| Melting point | 12℃ |
| Boiling point | 348.233°C at 760 mmHg |
| Flash point | 178.834°C |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
4712-55-4 diphenyl phosphite
service@apichina.com