| Product Name | dipentene fluka spec. purified fraction of terpene hydrocarb |
| CAS No. | 68956-56-9 |
| Synonyms | Dipentene Fluka specially purified fraction of terpene hydrocarbons; DIPENTENE EXTRA; 1-methyl-4-(propan-2-yl)cyclohexa-1,3-diene; Dipentene |
| InChI | InChI=1/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,6,8H,5,7H2,1-3H3 |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.234 |
| Density | 0.845g/cm3 |
| Boiling point | 174.1°C at 760 mmHg |
| Flash point | 46.1°C |
| Refractive index | 1.475 |
| Hazard Symbols |  Xi:Irritant;  N:Dangerous for the environment; |
| Risk Codes | R10:; R38:; R43:; R50/53:; R65:; |
| Safety | S2:; S24:; S37:; S60:; S61:; |
68956-56-9 dipentene fluka spec. purified fraction of terpene hydrocarb
service@apichina.com