| Product Name | Dinitrodurene |
| CAS No. | 5465-13-4 |
| Synonyms | 1,2,4,5-Tetramethyl-3,6-dinitrobenzene; Dinitrotrodurene |
| InChI | InChI=1/C10H12N2O4/c1-5-6(2)10(12(15)16)8(4)7(3)9(5)11(13)14/h1-4H3 |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.2133 |
| Density | 1.258g/cm3 |
| Melting point | 208-213℃ |
| Boiling point | 363.4°C at 760 mmHg |
| Flash point | 172.9°C |
| Refractive index | 1.572 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S24/25:Avoid contact with skin and eyes.; S37/39:Wear suitable gloves and eye/face protection.; |
5465-13-4 dinitrodurene
service@apichina.com