| Product Name | Dinitro-N-ethylaniline |
| CAS No. | 3846-50-2 |
| Synonyms | N-Ethyl-2,4-dinitroaniline; AI3-01554; NSC 406129; Benzenamine, N-ethyl-2,4-dinitro- |
| InChI | InChI=1/C8H9N3O4/c1-2-9-7-4-3-6(10(12)13)5-8(7)11(14)15/h3-5,9H,2H2,1H3 |
| Molecular Formula | C8H9N3O4 |
| Molecular Weight | 211.1748 |
| Density | 1.416g/cm3 |
| Melting point | 110-113℃ |
| Boiling point | 363.3°C at 760 mmHg |
| Flash point | 173.5°C |
| Refractive index | 1.638 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21:Harmful by inhalation and in contact with skin.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; |
3846-50-2 dinitro-n-ethylaniline
service@apichina.com