| Product Name | Dimethylcyanamide |
| CAS No. | 1467-79-4 |
| Synonyms | Dimethyl cyanamide; AI3-22164; CCRIS 5909; Cyanamide, dimethyl-; Dimethylkyanamid; Dimethylkyanamid [Czech]; HSDB 4274; N-Cyano-N-methylmethanamine; N-Cyanodimethylamine; NSC 7765; Cyanamide, N,N-dimethyl- |
| InChI | InChI=1/C3H6N2/c1-5(2)3-4/h1-2H3 |
| Molecular Formula | C3H6N2 |
| Molecular Weight | 70.0931 |
| Density | 0.89g/cm3 |
| Melting point | -41℃ |
| Boiling point | 163.5°C at 760 mmHg |
| Flash point | 58.3°C |
| Refractive index | 1.412 |
| Hazard Symbols |  T:Toxic; |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S28A:After contact with skin, wash immediately with plenty of water.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
1467-79-4 dimethylcyanamide
service@apichina.com