| Product Name | dimethylammonium 2,4,5-trichlorophenoxyacetate |
| CAS No. | 6369-97-7 |
| Synonyms | 2,4,5-T dimethylamine salt; 2,4,5-Trichlorophenoxyacetic acid dimethylamine salt; Caswell No. 881E; EPA Pesticide Chemical Code 082019; Acetic acid, (2,4,5-trichlorophenoxy)-, compd. with N-methylmethanamine (1:1); Dimethylammonium 2,4,5-trichlorophenoxyacetate; Acetic acid, (2,4,5-trichlorophenoxy)-, compd. with N-methylmethanamine; N-methylmethanaminium (2,4,5-trichlorophenoxy)acetate |
| InChI | InChI=1/C8H5Cl3O3.C2H7N/c9-4-1-6(11)7(2-5(4)10)14-3-8(12)13;1-3-2/h1-2H,3H2,(H,12,13);3H,1-2H3 |
| Molecular Formula | C10H12Cl3NO3 |
| Molecular Weight | 300.5662 |
| Boiling point | 376.3°C at 760 mmHg |
| Flash point | 181.4°C |
6369-97-7 dimethylammonium 2,4,5-trichlorophenoxyacetate
service@apichina.com