| Product Name | (Dimethylaminomethylene)malononitrile |
| CAS No. | 16849-88-0 |
| Synonyms | 2-[(dimethylamino)methylidene]malononitrile; [(dimethylamino)methylidene]propanedinitrile |
| InChI | InChI=1/C6H7N3/c1-9(2)5-6(3-7)4-8/h5H,1-2H3 |
| Molecular Formula | C6H7N3 |
| Molecular Weight | 121.1399 |
| Density | 1.053g/cm3 |
| Melting point | 84-85℃ |
| Boiling point | 413.3°C at 760 mmHg |
| Flash point | 209.1°C |
| Refractive index | 1.49 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21:Harmful by inhalation and in contact with skin.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; |
16849-88-0 (dimethylaminomethylene)malononitrile
service@apichina.com