| Product Name | Dimethyl terephthalate |
| CAS No. | 120-61-6 |
| Synonyms | D.M.T.; Terephthalic acid dimethyl ester; Benzene-1,4-dicarboxylic acid dimethyl ester; Terephthalic acid dimethyl ester; dimethyl cyclohexane-1,4-dicarboxylate; 1,3-benzodioxol-5-yl methylcarbamate; dimethyl benzene-1,4-dicarboxylate; 4-(methoxycarbonyl)benzoic acid; dimethyl benzene-1,2-dicarboxylate; DMT |
| InChI | InChI=1/C10H10O4/c1-13-9(11)7-5-3-4-6-8(7)10(12)14-2/h3-6H,1-2H3 |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.184 |
| Density | 1.175g/cm3 |
| Melting point | 140-143℃ |
| Boiling point | 282.7°C at 760 mmHg |
| Flash point | 146.7°C |
| Refractive index | 1.514 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
120-61-6 dimethyl terephthalate
service@apichina.com