| Product Name | Dimethyl pimelate |
| CAS No. | 1732-08-7 |
| Synonyms | Dimethyl 1,7-Heptanedioate; Heptanedioic acid dimethyl ester; Pimelic acid dimethyl ester; dimethyl heptanedioate |
| InChI | InChI=1/C9H16O4/c1-12-8(10)6-4-3-5-7-9(11)13-2/h3-7H2,1-2H3 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.2209 |
| Density | 1.022g/cm3 |
| Boiling point | 250.3°C at 760 mmHg |
| Flash point | 105.4°C |
| Refractive index | 1.427 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
1732-08-7 dimethyl pimelate
service@apichina.com