| Product Name | dimethyl naphthalene-2,6-dicarboxylate |
| CAS No. | 840-65-3 |
| Synonyms | Naphthalene-2,6-dicarboxylic acid dimethyl ester; Dimethyl-2,6-naphthalene dicaboxylate; 2,6-DMN; Dimethyl 2,6-Naphthalenedicarboxylate |
| InChI | InChI=1/C14H12O4/c1-17-13(15)11-5-3-10-8-12(14(16)18-2)6-4-9(10)7-11/h3-8H,1-2H3 |
| Molecular Formula | C14H12O4 |
| Molecular Weight | 244.2427 |
| Density | 1.225g/cm3 |
| Melting point | 187-190℃ |
| Boiling point | 375.3°C at 760 mmHg |
| Flash point | 189.2°C |
| Refractive index | 1.594 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
840-65-3 dimethyl naphthalene-2,6-dicarboxylate
service@apichina.com