| Product Name | dimethyl fluoromalonate |
| CAS No. | 344-14-9 |
| Synonyms | Fluoromalonic acid dimethyl ester; dimethyl fluoropropanedioate; 2-Fluoro-malonic acid dimethyl ester |
| InChI | InChI=1/C5H7FO4/c1-9-4(7)3(6)5(8)10-2/h3H,1-2H3 |
| Molecular Formula | C5H7FO4 |
| Molecular Weight | 150.1051 |
| Density | 1.211g/cm3 |
| Boiling point | 140.3°C at 760 mmHg |
| Flash point | 38.4°C |
| Refractive index | 1.382 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
344-14-9 dimethyl fluoromalonate
service@apichina.com