| Product Name | dimethyl dodecanedioate |
| CAS No. | 1731-79-9 |
| Synonyms | Dimethyl 1,10-decanedicarboxylate; 1,10-Decanedicarboxylic acid dimethyl ester~Dodecanedioic acid dimethyl ester; Dodecanedioic acid dimethyl ester; N-(2-Chloroethyl) Pyrrolinie HCl |
| InChI | InChI=1/C14H26O4/c1-17-13(15)11-9-7-5-3-4-6-8-10-12-14(16)18-2/h3-12H2,1-2H3 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.3538 |
| Density | 0.969g/cm3 |
| Boiling point | 300.9°C at 760 mmHg |
| Flash point | 135°C |
| Refractive index | 1.441 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
1731-79-9 dimethyl dodecanedioate
service@apichina.com