| Product Name | Dimethyl diallylmalonate |
| CAS No. | 35357-77-8 |
| Synonyms | Dimethyl diallylmalonate, (Diallylmalonic acid dimethyl ester); Diallylmalonic acid dimethyl ester; dimethyl diprop-2-en-1-ylpropanedioate; diprop-2-en-1-yl pentanedioate |
| InChI | InChI=1/C11H16O4/c1-3-8-14-10(12)6-5-7-11(13)15-9-4-2/h3-4H,1-2,5-9H2 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.2423 |
| Density | 1.024g/cm3 |
| Boiling point | 270.7°C at 760 mmHg |
| Flash point | 125.4°C |
| Refractive index | 1.452 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
35357-77-8 dimethyl diallylmalonate
service@apichina.com