| Product Name | dimethyl butane-1,4-diylbis(nitrosocarbamate) |
| CAS No. | 40002-44-6 |
| InChI | InChI=1/C8H14N4O6/c1-17-7(13)11(9-15)5-3-4-6-12(10-16)8(14)18-2/h3-6H2,1-2H3 |
| Molecular Formula | C8H14N4O6 |
| Molecular Weight | 262.22 |
| Density | 1.35g/cm3 |
| Boiling point | 335.7°C at 760 mmHg |
| Flash point | 156.8°C |
| Refractive index | 1.526 |
40002-44-6 dimethyl butane-1,4-diylbis(nitrosocarbamate)
service@apichina.com