| Product Name | Dimethyl 3-nitrophthalate |
| CAS No. | 13365-26-9 |
| Synonyms | 3-Nitrophthalic acid dimethyl ester; dimethyl 3-nitrobenzene-1,2-dicarboxylate |
| InChI | InChI=1/C10H9NO6/c1-16-9(12)6-4-3-5-7(11(14)15)8(6)10(13)17-2/h3-5H,1-2H3 |
| Molecular Formula | C10H9NO6 |
| Molecular Weight | 239.1816 |
| Density | 1.35g/cm3 |
| Boiling point | 314.6°C at 760 mmHg |
| Flash point | 134.3°C |
| Refractive index | 1.549 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
13365-26-9 dimethyl 3-nitrophthalate
service@apichina.com