| Product Name | dimethyl 3-methylglutaconate, mixture of ci |
| CAS No. | 52313-87-8 |
| Synonyms | Dimethyl 3-methylglutaconate,mixture of cis and trans; dimethyl 3-methylpent-2-enedioate; dimethyl (2Z)-3-methylpent-2-enedioate; Dimethyl 3-methylglutaconate |
| InChI | InChI=1/C8H12O4/c1-6(4-7(9)11-2)5-8(10)12-3/h4H,5H2,1-3H3/b6-4- |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.1785 |
| Density | 1.069g/cm3 |
| Boiling point | 232.8°C at 760 mmHg |
| Flash point | 96.7°C |
| Refractive index | 1.441 |
52313-87-8 dimethyl 3-methylglutaconate, mixture of ci
service@apichina.com