| Product Name | Dimethyl 2,5-pyridinedicarboxylate |
| CAS No. | 881-86-7 |
| Synonyms | Dimethyl pyridine-2,5-dicarboxylate; Dimethyl isocinchomeronate; Pyridine-2,5-dicarboxylic acid dimethyl ester; Dimethyl-2,5-pyridinecarboxylate |
| InChI | InChI=1/C9H9NO4/c1-13-8(11)6-3-4-7(10-5-6)9(12)14-2/h3-5H,1-2H3 |
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.1721 |
| Density | 1.231g/cm3 |
| Melting point | 213-217℃ |
| Boiling point | 302.9°C at 760 mmHg |
| Flash point | 137°C |
| Refractive index | 1.516 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
881-86-7 dimethyl 2,5-pyridinedicarboxylate
service@apichina.com