| Product Name | Dimethyl 1,1-cyclobutanedicarboxylate |
| CAS No. | 10224-72-3 |
| Synonyms | 1,1-Cyclobutanedicarboxylic acid dimethyl ester; Dimethyl1,1-cyclobutanedicarboxylate, (1,1-Cyclobutanedicarboxylicacid dimethylester); dimethyl cyclobutane-1,1-dicarboxylate |
| InChI | InChI=1/C8H12O4/c1-11-6(9)8(4-3-5-8)7(10)12-2/h3-5H2,1-2H3 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.1785 |
| Density | 1.19g/cm3 |
| Boiling point | 182.6°C at 760 mmHg |
| Flash point | 79.5°C |
| Refractive index | 1.468 |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S24/25:Avoid contact with skin and eyes.; |
10224-72-3 dimethyl 1,1-cyclobutanedicarboxylate
service@apichina.com