| Product Name | Dimethoxyiodobenzene |
| CAS No. | 20469-63-0 |
| Synonyms | 1,3-Dimethoxy-4-iodobenzene; 1-Iodo-2,4-dimethoxybenzene; Benzene, 1-iodo-2,4-dimethoxy-; 2,4-Dimethoxyiodobenzene |
| InChI | InChI=1/C8H9IO2/c1-10-6-3-4-7(9)8(5-6)11-2/h3-5H,1-2H3 |
| Molecular Formula | C8H9IO2 |
| Molecular Weight | 264.0603 |
| Density | 1.655g/cm3 |
| Melting point | 37-41℃ |
| Boiling point | 284.3°C at 760 mmHg |
| Flash point | 125.7°C |
| Refractive index | 1.572 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
20469-63-0 dimethoxyiodobenzene
service@apichina.com